C21H19NO5 — CID 98275176
(1S,2R,3S,4S)-3-[(2-methoxy-5-phenylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98275176) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (1S,2R,3S,4S)-3-[(2-methoxy-5-phenylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4S)-3-[(2-methoxy-5-phenylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98275176 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (1S,2R,3S,4S)-3-[(2-methoxy-5-phenylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COc1ccc(-c2ccccc2)cc1NC(=O)[C@H]1[C@@H](C(=O)O)[C@@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C21H19NO5/c1-26-15-8-7-13(12-5-3-2-4-6-12)11-14(15)22-20(23)18-16-9-10-17(27-16)19(18)21(24)25/h2-11,16-19H,1H3,(H,22,23)(H,24,25)/t16-,17-,18+,19-/m0/s1 |
| InChIKey | PCBJUYJXNXXCMY-OKYOBFRVSA-N |
| XLogP | 2.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|