C10H8N4O3 — CID 98276339
(3aR,4S,7S,7aS)-2-(1,2,4-triazol-4-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98276339) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is (3aR,4S,7S,7aS)-2-(1,2,4-triazol-4-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aS)-2-(1,2,4-triazol-4-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98276339 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (3aR,4S,7S,7aS)-2-(1,2,4-triazol-4-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1n1cnnc1)[C@@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C10H8N4O3/c15-9-7-5-1-2-6(17-5)8(7)10(16)14(9)13-3-11-12-4-13/h1-8H/t5-,6-,7-,8+/m0/s1 |
| InChIKey | FUZVBSJTMVLHGW-DKXJUACHSA-N |
| XLogP | -1.15 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|