C18H17Br2N3O5S — CID 98278499
ethyl (5R)-5-(3,5-dibromo-2,4-dihydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 98278499) has the molecular formula C18H17Br2N3O5S and a molecular weight of 547.23 g/mol. Its IUPAC name is ethyl (5R)-5-(3,5-dibromo-2,4-dihydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl (5R)-5-(3,5-dibromo-2,4-dihydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 98278499 |
| Molecular Formula | C18H17Br2N3O5S |
| Molecular Weight | 547.23 g/mol |
| Exact Mass | 544.93 |
| IUPAC Name | ethyl (5R)-5-(3,5-dibromo-2,4-dihydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)N[C@@H](c2cc(Br)c(O)c(Br)c2O)N3)C1 |
| InChI | InChI=1S/C18H17Br2N3O5S/c1-2-28-18(27)23-4-3-7-10(6-23)29-17-11(7)16(26)21-15(22-17)8-5-9(19)14(25)12(20)13(8)24/h5,15,22,24-25H,2-4,6H2,1H3,(H,21,26)/t15-/m1/s1 |
| InChIKey | FYRXANGHODKITE-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|