C26H24N2O4 — CID 98279841
(2R)-N-(4-acetylphenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide (PubChem CID 98279841) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2R)-N-(4-acetylphenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide.
| Compound Name | (2R)-N-(4-acetylphenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 98279841 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (2R)-N-(4-acetylphenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H](Cc2ccccc2)N2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2C=C[C@H]3C2)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-15(29)17-9-11-20(12-10-17)27-24(30)21(13-16-5-3-2-4-6-16)28-25(31)22-18-7-8-19(14-18)23(22)26(28)32/h2-12,18-19,21-23H,13-14H2,1H3,(H,27,30)/t18-,19-,21+,22-,23-/m0/s1 |
| InChIKey | PLDPZSGNYYPGFG-WIEKXJNISA-N |
| XLogP | 3.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|