C19H20BrNO5 — CID 98280449
(1S,2S,4S,5R,6S,7R)-7-[(4-bromo-2,5-dimethoxyphenyl)carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid (PubChem CID 98280449) has the molecular formula C19H20BrNO5 and a molecular weight of 422.28 g/mol. Its IUPAC name is (1S,2S,4S,5R,6S,7R)-7-[(4-bromo-2,5-dimethoxyphenyl)carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid.
| Compound Name | (1S,2S,4S,5R,6S,7R)-7-[(4-bromo-2,5-dimethoxyphenyl)carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 98280449 |
| Molecular Formula | C19H20BrNO5 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | (1S,2S,4S,5R,6S,7R)-7-[(4-bromo-2,5-dimethoxyphenyl)carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
| SMILES | COc1cc(NC(=O)[C@@H]2[C@H]3C=C[C@H]([C@H]4C[C@H]34)[C@@H]2C(=O)O)c(OC)cc1Br |
| InChI | InChI=1S/C19H20BrNO5/c1-25-14-7-13(15(26-2)6-12(14)20)21-18(22)16-8-3-4-9(11-5-10(8)11)17(16)19(23)24/h3-4,6-11,16-17H,5H2,1-2H3,(H,21,22)(H,23,24)/t8-,9+,10+,11+,16+,17-/m0/s1 |
| InChIKey | HNOWGZJYQOAROQ-WENXKWCGSA-N |
| XLogP | 3.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|