C17H12ClFN4O — CID 98282052
(6R)-6-(chloromethyl)-3-(4-fluorophenyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one (PubChem CID 98282052) has the molecular formula C17H12ClFN4O and a molecular weight of 342.76 g/mol. Its IUPAC name is (6R)-6-(chloromethyl)-3-(4-fluorophenyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one.
| Compound Name | (6R)-6-(chloromethyl)-3-(4-fluorophenyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one |
|---|---|
| PubChem CID | 98282052 |
| Molecular Formula | C17H12ClFN4O |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (6R)-6-(chloromethyl)-3-(4-fluorophenyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one |
| SMILES | O=c1nc2n(nc1-c1ccc(F)cc1)[C@H](CCl)Nc1ccccc1-2 |
| InChI | InChI=1S/C17H12ClFN4O/c18-9-14-20-13-4-2-1-3-12(13)16-21-17(24)15(22-23(14)16)10-5-7-11(19)8-6-10/h1-8,14,20H,9H2/t14-/m1/s1 |
| InChIKey | QQPQIYLHRHRGIY-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|