C24H34ClN3O — CID 98282549
(5R,7R)-3-chloro-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]adamantane-1-carboxamide (PubChem CID 98282549) has the molecular formula C24H34ClN3O and a molecular weight of 416.01 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98282549 |
| Molecular Formula | C24H34ClN3O |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (5R,7R)-3-chloro-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]adamantane-1-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)C34C[C@H]5C[C@@H](CC(Cl)(C5)C3)C4)cc2C)CC1 |
| InChI | InChI=1S/C24H34ClN3O/c1-3-27-6-8-28(9-7-27)21-5-4-20(10-17(21)2)26-22(29)23-12-18-11-19(13-23)15-24(25,14-18)16-23/h4-5,10,18-19H,3,6-9,11-16H2,1-2H3,(H,26,29)/t18-,19-,23?,24?/m1/s1 |
| InChIKey | GSHOQKHLSGGOHF-UOYQGRGCSA-N |
| XLogP | 4.65 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|