C23H30N2O7S — CID 98283156
ethyl 2-[[2-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyloxy]acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 98283156) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyloxy]acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyloxy]acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 98283156 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | ethyl 2-[[2-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyloxy]acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)CCN2C(=O)[C@@H]3CCCC[C@H]3C2=O)sc(C)c1CC |
| InChI | InChI=1S/C23H30N2O7S/c1-4-14-13(3)33-20(19(14)23(30)31-5-2)24-17(26)12-32-18(27)10-11-25-21(28)15-8-6-7-9-16(15)22(25)29/h15-16H,4-12H2,1-3H3,(H,24,26)/t15-,16-/m1/s1 |
| InChIKey | KNDMIVJYJCLRIH-HZPDHXFCSA-N |
| XLogP | 2.84 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|