C26H22ClNO4 — CID 98284570
(4-chloro-3,5-dimethylphenyl) 4-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate (PubChem CID 98284570) has the molecular formula C26H22ClNO4 and a molecular weight of 447.92 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 4-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 4-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
|---|---|
| PubChem CID | 98284570 |
| Molecular Formula | C26H22ClNO4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 4-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(N3C(=O)[C@H]4[C@@H]5C=C[C@@H]([C@H]6C[C@H]56)[C@@H]4C3=O)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C26H22ClNO4/c1-12-9-16(10-13(2)23(12)27)32-26(31)14-3-5-15(6-4-14)28-24(29)21-17-7-8-18(20-11-19(17)20)22(21)25(28)30/h3-10,17-22H,11H2,1-2H3/t17-,18+,19-,20-,21+,22+/m1/s1 |
| InChIKey | BXIYIWNAVDDZBX-HJEMKOJISA-N |
| XLogP | 4.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|