C14H20N2O2S2 — CID 98284660
[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1,3,4-thiadiazol-2-ylsulfanyl)acetate (PubChem CID 98284660) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1,3,4-thiadiazol-2-ylsulfanyl)acetate.
| Compound Name | [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1,3,4-thiadiazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 98284660 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1,3,4-thiadiazol-2-ylsulfanyl)acetate |
| SMILES | C[C@H]1[C@@H](OC(=O)CSc2nncs2)C[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C14H20N2O2S2/c1-8-10-4-9(14(10,2)3)5-11(8)18-12(17)6-19-13-16-15-7-20-13/h7-11H,4-6H2,1-3H3/t8-,9-,10-,11+/m1/s1 |
| InChIKey | HCDFNNFXTGQEET-DBIOUOCHSA-N |
| XLogP | 3.24 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |