C16H22F3N5O2 — CID 98285766
5-[[[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-methylamino]methyl]-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 98285766) has the molecular formula C16H22F3N5O2 and a molecular weight of 373.38 g/mol. Its IUPAC name is 5-[[[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-methylamino]methyl]-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[[[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-methylamino]methyl]-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 98285766 |
| Molecular Formula | C16H22F3N5O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 5-[[[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-methylamino]methyl]-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CO[C@@]1(C)C[C@H](N(C)Cc2cc(=O)n3[nH]c(C(F)(F)F)nc3n2)C1(C)C |
| InChI | InChI=1S/C16H22F3N5O2/c1-14(2)10(7-15(14,3)26-5)23(4)8-9-6-11(25)24-13(20-9)21-12(22-24)16(17,18)19/h6,10H,7-8H2,1-5H3,(H,20,21,22)/t10-,15-/m0/s1 |
| InChIKey | ZEBXXVAGVWDLKQ-BONVTDFDSA-N |
| XLogP | 2.07 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |