C15H15N3O5S — CID 98286192
methyl 2-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 98286192) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is methyl 2-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98286192 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | methyl 2-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NC(=O)CN2C(=O)[C@H]3CC=CC[C@@H]3C2=O)s1 |
| InChI | InChI=1S/C15H15N3O5S/c1-23-14(22)10-6-16-15(24-10)17-11(19)7-18-12(20)8-4-2-3-5-9(8)13(18)21/h2-3,6,8-9H,4-5,7H2,1H3,(H,16,17,19)/t8-,9-/m0/s1 |
| InChIKey | CXFKKRATAGHIMY-IUCAKERBSA-N |
| XLogP | 0.82 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|