C31H42N2O4 — CID 98286924
(4E,5S)-5-(4-tert-butylphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione (PubChem CID 98286924) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is (4E,5S)-5-(4-tert-butylphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(4-tert-butylphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98286924 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | (4E,5S)-5-(4-tert-butylphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1cc(OCC(C)C)ccc1/C(O)=C1\C(=O)C(=O)N(CCCN(C)C)[C@H]1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H42N2O4/c1-20(2)19-37-24-14-15-25(21(3)18-24)28(34)26-27(22-10-12-23(13-11-22)31(4,5)6)33(30(36)29(26)35)17-9-16-32(7)8/h10-15,18,20,27,34H,9,16-17,19H2,1-8H3/b28-26+/t27-/m0/s1 |
| InChIKey | QCINIONBMLTQJK-ONQGDUAMSA-N |
| XLogP | 5.70 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|