C12H20O2 — CID 98287617
ethyl 3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]propanoate (PubChem CID 98287617) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is ethyl 3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]propanoate.
| Compound Name | ethyl 3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]propanoate |
|---|---|
| PubChem CID | 98287617 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | ethyl 3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]propanoate |
| SMILES | CCOC(=O)CC[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H20O2/c1-2-14-12(13)6-5-11-8-9-3-4-10(11)7-9/h9-11H,2-8H2,1H3/t9-,10-,11-/m0/s1 |
| InChIKey | AMNZGAJUSFXSFY-DCAQKATOSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |