C17H18Br2N2O5 — CID 98287786
[2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 98287786) has the molecular formula C17H18Br2N2O5 and a molecular weight of 490.15 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 98287786 |
| Molecular Formula | C17H18Br2N2O5 |
| Molecular Weight | 490.15 g/mol |
| Exact Mass | 487.96 |
| IUPAC Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(COC(=O)C[C@@H]1C[C@H]2CC[C@H]1C2)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C17H18Br2N2O5/c18-13-6-12(21(24)25)7-14(19)17(13)20-15(22)8-26-16(23)5-11-4-9-1-2-10(11)3-9/h6-7,9-11H,1-5,8H2,(H,20,22)/t9-,10-,11-/m0/s1 |
| InChIKey | HVYLUEKBCIARCL-DCAQKATOSA-N |
| XLogP | 4.43 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.15 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|