C14H16N2O5S — CID 98289174
(1S,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 98289174) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 98289174 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (1S,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cc1ccsc1C(=O)NNC(=O)[C@@H]1[C@@H](C(=O)O)[C@@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C14H16N2O5S/c1-6-4-5-22-11(6)13(18)16-15-12(17)9-7-2-3-8(21-7)10(9)14(19)20/h4-5,7-10H,2-3H2,1H3,(H,15,17)(H,16,18)(H,19,20)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | VCLCYBCASZVNOJ-XKNYDFJKSA-N |
| XLogP | 0.70 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|