C19H18BrFN2O2S — CID 98289742
(1R,9S)-10-(4-bromo-2-fluorophenyl)-6-ethoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione (PubChem CID 98289742) has the molecular formula C19H18BrFN2O2S and a molecular weight of 437.33 g/mol. Its IUPAC name is (1R,9S)-10-(4-bromo-2-fluorophenyl)-6-ethoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione.
| Compound Name | (1R,9S)-10-(4-bromo-2-fluorophenyl)-6-ethoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
|---|---|
| PubChem CID | 98289742 |
| Molecular Formula | C19H18BrFN2O2S |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | (1R,9S)-10-(4-bromo-2-fluorophenyl)-6-ethoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
| SMILES | CCOc1cccc2c1O[C@@]1(C)C[C@H]2NC(=S)N1c1ccc(Br)cc1F |
| InChI | InChI=1S/C19H18BrFN2O2S/c1-3-24-16-6-4-5-12-14-10-19(2,25-17(12)16)23(18(26)22-14)15-8-7-11(20)9-13(15)21/h4-9,14H,3,10H2,1-2H3,(H,22,26)/t14-,19+/m1/s1 |
| InChIKey | AVSOXJMJTLGZCY-KUHUBIRLSA-N |
| XLogP | 4.92 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|