C10H21NO — CID 98289832
[(1R,3R,4R)-4-amino-2,2,3-trimethylcyclohexyl]methanol (PubChem CID 98289832) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is [(1R,3R,4R)-4-amino-2,2,3-trimethylcyclohexyl]methanol.
| Compound Name | [(1R,3R,4R)-4-amino-2,2,3-trimethylcyclohexyl]methanol |
|---|---|
| PubChem CID | 98289832 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | [(1R,3R,4R)-4-amino-2,2,3-trimethylcyclohexyl]methanol |
| SMILES | C[C@H]1[C@H](N)CC[C@@H](CO)C1(C)C |
| InChI | InChI=1S/C10H21NO/c1-7-9(11)5-4-8(6-12)10(7,2)3/h7-9,12H,4-6,11H2,1-3H3/t7-,8-,9+/m0/s1 |
| InChIKey | WJVBQTINNYBSQR-XHNCKOQMSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |