C20H18N2O3S — CID 98290260
N-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5-methyl-4-phenylthiophene-3-carboxamide (PubChem CID 98290260) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5-methyl-4-phenylthiophene-3-carboxamide.
| Compound Name | N-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5-methyl-4-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 98290260 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5-methyl-4-phenylthiophene-3-carboxamide |
| SMILES | Cc1scc(C(=O)NN2C(=O)[C@H]3CC=CC[C@@H]3C2=O)c1-c1ccccc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-12-17(13-7-3-2-4-8-13)16(11-26-12)18(23)21-22-19(24)14-9-5-6-10-15(14)20(22)25/h2-8,11,14-15H,9-10H2,1H3,(H,21,23)/t14-,15-/m0/s1 |
| InChIKey | LHJCBQUDWQEODX-GJZGRUSLSA-N |
| XLogP | 3.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|