C19H22N2O6 — CID 98291829
[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 98291829) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 98291829 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | C[C@H]1[C@@H](OC(=O)Cn2c(=O)oc3cc([N+](=O)[O-])ccc32)C[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C19H22N2O6/c1-10-13-6-11(19(13,2)3)7-15(10)26-17(22)9-20-14-5-4-12(21(24)25)8-16(14)27-18(20)23/h4-5,8,10-11,13,15H,6-7,9H2,1-3H3/t10-,11-,13-,15+/m1/s1 |
| InChIKey | JBWKWXXDDRGBNN-CVMIBZJCSA-N |
| XLogP | 3.12 |
| TPSA | 104.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|