C29H36ClN3O2 — CID 98292434
(2R,8aR)-N-[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine-2-carboxamide (PubChem CID 98292434) has the molecular formula C29H36ClN3O2 and a molecular weight of 494.08 g/mol. Its IUPAC name is (2R,8aR)-N-[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine-2-carboxamide.
| Compound Name | (2R,8aR)-N-[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine-2-carboxamide |
|---|---|
| PubChem CID | 98292434 |
| Molecular Formula | C29H36ClN3O2 |
| Molecular Weight | 494.08 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (2R,8aR)-N-[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)C1CCC(c2ccc(NC(=O)[C@@H]3C[C@H]4CCCCN4C3)cc2)CC1 |
| InChI | InChI=1S/C29H36ClN3O2/c1-32(29(35)22-5-11-24(30)12-6-22)26-15-9-21(10-16-26)20-7-13-25(14-8-20)31-28(34)23-18-27-4-2-3-17-33(27)19-23/h5-8,11-14,21,23,26-27H,2-4,9-10,15-19H2,1H3,(H,31,34)/t21?,23-,26?,27-/m1/s1 |
| InChIKey | CJFCBDMYNMAAQG-HCGZQQGESA-N |
| XLogP | 5.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.08 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |