C14H24ClNO — CID 98292617
(2S)-2-chloro-N-[(1R,3R,5R)-3-ethyl-1-bicyclo[3.3.1]nonanyl]propanamide (PubChem CID 98292617) has the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. Its IUPAC name is (2S)-2-chloro-N-[(1R,3R,5R)-3-ethyl-1-bicyclo[3.3.1]nonanyl]propanamide.
| Compound Name | (2S)-2-chloro-N-[(1R,3R,5R)-3-ethyl-1-bicyclo[3.3.1]nonanyl]propanamide |
|---|---|
| PubChem CID | 98292617 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (2S)-2-chloro-N-[(1R,3R,5R)-3-ethyl-1-bicyclo[3.3.1]nonanyl]propanamide |
| SMILES | CC[C@@H]1C[C@H]2CCC[C@@](NC(=O)[C@H](C)Cl)(C1)C2 |
| InChI | InChI=1S/C14H24ClNO/c1-3-11-7-12-5-4-6-14(8-11,9-12)16-13(17)10(2)15/h10-12H,3-9H2,1-2H3,(H,16,17)/t10-,11+,12+,14+/m0/s1 |
| InChIKey | OCXWIIXCVMUXFX-FMCLSXCISA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|