About 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde
4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde (PubChem CID 98292764) has the molecular formula C15H15F2N3O3
and a molecular weight of 323.30 g/mol. Its IUPAC name is 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde |
| PubChem CID | 98292764 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN([C@H]2CC(=O)N(c3ccc(F)c(F)c3)C2=O)CC1 |
| InChI | InChI=1S/C15H15F2N3O3/c16-11-2-1-10(7-12(11)17)20-14(22)8-13(15(20)23)19-5-3-18(9-21)4-6-19/h1-2,7,9,13H,3-6,8H2/t13-/m0/s1 |
| InChIKey | STXPFFQWWFTSOE-ZDUSSCGKSA-N |
| XLogP | 0.37 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde?
The IUPAC name of 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde (CID 98292764) is 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde.
What is the SMILES notation for 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde?
The canonical SMILES for 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde is O=CN1CCN([C@H]2CC(=O)N(c3ccc(F)c(F)c3)C2=O)CC1.
What is the InChIKey of 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde?
The InChIKey is STXPFFQWWFTSOE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H15F2N3O3/c16-11-2-1-10(7-12(11)17)20-14(22)8-13(15(20)23)19-5-3-18(9-21)4-6-19/h1-2,7,9,13H,3-6,8H2/t13-/m0/s1.
What are the key properties of 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde?
4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde has a molecular weight of 323.30 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carbaldehyde is sourced from PubChem (CID 98292764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).