C29H32N4O4S — CID 98293614
(2S)-2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 98293614) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is (2S)-2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | (2S)-2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 98293614 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (2S)-2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | Cc1ccccc1[C@H]1c2ccsc2CCN1[C@@H](C)C(=O)N1CCCN(C(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C29H32N4O4S/c1-20-7-3-4-10-24(20)27-25-12-18-38-26(25)11-15-32(27)21(2)28(34)30-13-6-14-31(17-16-30)29(35)22-8-5-9-23(19-22)33(36)37/h3-5,7-10,12,18-19,21,27H,6,11,13-17H2,1-2H3/t21-,27-/m0/s1 |
| InChIKey | IIENCAGXWKQWKV-IDISGSTGSA-N |
| XLogP | 4.68 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|