C18H21NO5S — CID 98294330
(1R,2S,3S,4R)-3-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 98294330) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4R)-3-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98294330 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (1R,2S,3S,4R)-3-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)[C@@H]1[C@@H](C(=O)O)[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C18H21NO5S/c1-3-24-18(23)12-8-9(2)25-16(12)19-15(20)13-10-4-6-11(7-5-10)14(13)17(21)22/h4,6,8,10-11,13-14H,3,5,7H2,1-2H3,(H,19,20)(H,21,22)/t10-,11-,13-,14-/m0/s1 |
| InChIKey | ROMMXGFGJTUBFT-IMIFBBOLSA-N |
| XLogP | 3.08 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|