C20H19N5O4 — CID 98296746
(3S,4E)-4-(carbamoylhydrazinylidene)-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 98296746) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is (3S,4E)-4-(carbamoylhydrazinylidene)-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4E)-4-(carbamoylhydrazinylidene)-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 98296746 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (3S,4E)-4-(carbamoylhydrazinylidene)-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@H]1C(=O)N(c2ccccc2C)C(=O)/C1=N/NC(N)=O |
| InChI | InChI=1S/C20H19N5O4/c1-11-7-3-5-9-13(11)22-17(26)15-16(23-24-20(21)29)19(28)25(18(15)27)14-10-6-4-8-12(14)2/h3-10,15H,1-2H3,(H,22,26)(H3,21,24,29)/b23-16+/t15-/m0/s1 |
| InChIKey | WUXOSWOZTOAZIG-IXSYQRGLSA-N |
| XLogP | 1.46 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|