C20H26N2O4 — CID 98299173
(3R)-3-[2-[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-6,7-dimethyl-1,3-dihydroindol-2-one (PubChem CID 98299173) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is (3R)-3-[2-[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-6,7-dimethyl-1,3-dihydroindol-2-one.
| Compound Name | (3R)-3-[2-[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-6,7-dimethyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 98299173 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (3R)-3-[2-[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-6,7-dimethyl-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc2c(c1C)NC(=O)[C@@H]2CC(=O)N1C[C@H]2C[C@H](O)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H26N2O4/c1-10-3-4-14-15(20(26)21-19(14)11(10)2)7-18(25)22-8-12-5-16(23)17(24)6-13(12)9-22/h3-4,12-13,15-17,23-24H,5-9H2,1-2H3,(H,21,26)/t12-,13+,15-,16+,17-/m1/s1 |
| InChIKey | HZFTXLACHOWKNE-PEHHYFEISA-N |
| XLogP | 1.32 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |