C8H5ClF3NO — CID 9830
N-(4-chlorophenyl)-2,2,2-trifluoroacetamide (PubChem CID 9830) has the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-chlorophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 9830 |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.58 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | N-(4-chlorophenyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H5ClF3NO/c9-5-1-3-6(4-2-5)13-7(14)8(10,11)12/h1-4H,(H,13,14) |
| InChIKey | PEFCIPXJRCETGI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |