C20H22N2O3 — CID 98304386
(2R)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(3-methylphenyl)propanamide (PubChem CID 98304386) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2R)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(3-methylphenyl)propanamide.
| Compound Name | (2R)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 98304386 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2R)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)[C@@H](C)N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3CC2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-11-4-3-5-15(10-11)21-18(23)12(2)22-19(24)16-13-6-7-14(9-8-13)17(16)20(22)25/h3-7,10,12-14,16-17H,8-9H2,1-2H3,(H,21,23)/t12-,13+,14+,16-,17+/m1/s1 |
| InChIKey | XCDJPJHKZNYUMT-PYOKUCOHSA-N |
| XLogP | 2.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|