C6H9Cl2N3 — CID 98306481
3,5-bis[(1R)-1-chloroethyl]-1H-1,2,4-triazole (PubChem CID 98306481) has the molecular formula C6H9Cl2N3 and a molecular weight of 194.07 g/mol. Its IUPAC name is 3,5-bis[(1R)-1-chloroethyl]-1H-1,2,4-triazole.
| Compound Name | 3,5-bis[(1R)-1-chloroethyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 98306481 |
| Molecular Formula | C6H9Cl2N3 |
| Molecular Weight | 194.07 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 3,5-bis[(1R)-1-chloroethyl]-1H-1,2,4-triazole |
| SMILES | C[C@@H](Cl)c1n[nH]c([C@@H](C)Cl)n1 |
| InChI | InChI=1S/C6H9Cl2N3/c1-3(7)5-9-6(4(2)8)11-10-5/h3-4H,1-2H3,(H,9,10,11)/t3-,4-/m1/s1 |
| InChIKey | NEXYHAPKUCSMLC-QWWZWVQMSA-N |
| XLogP | 2.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.07 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|