C20H24F3N3O3 — CID 98307617
(1R,2S,3R,4R)-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 98307617) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98307617 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (1R,2S,3R,4R)-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H](C(=O)NCCCn2nc(C(F)(F)F)cc2C2CC2)[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C20H24F3N3O3/c21-20(22,23)15-10-14(11-2-3-11)26(25-15)9-1-8-24-18(27)16-12-4-6-13(7-5-12)17(16)19(28)29/h4,6,10-13,16-17H,1-3,5,7-9H2,(H,24,27)(H,28,29)/t12-,13-,16+,17-/m0/s1 |
| InChIKey | RGAGQKMRRLTDJO-CLROSIBMSA-N |
| XLogP | 3.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|