C17H25N5O — CID 98308306
[(1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-[(9S)-6,7,8,9-tetrahydro-5H-tetrazolo[1,5-a]azepin-9-yl]methanone (PubChem CID 98308306) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is [(1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-[(9S)-6,7,8,9-tetrahydro-5H-tetrazolo[1,5-a]azepin-9-yl]methanone.
| Compound Name | [(1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-[(9S)-6,7,8,9-tetrahydro-5H-tetrazolo[1,5-a]azepin-9-yl]methanone |
|---|---|
| PubChem CID | 98308306 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | [(1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-[(9S)-6,7,8,9-tetrahydro-5H-tetrazolo[1,5-a]azepin-9-yl]methanone |
| SMILES | O=C([C@H]1CCCCn2nnnc21)N1CC2C[C@H]3CC1C[C@H](C2)C3 |
| InChI | InChI=1S/C17H25N5O/c23-17(15-3-1-2-4-22-16(15)18-19-20-22)21-10-13-6-11-5-12(7-13)9-14(21)8-11/h11-15H,1-10H2/t11-,12-,13?,14?,15-/m0/s1 |
| InChIKey | QUCASYGFSRULND-FOZYDTHFSA-N |
| XLogP | 1.98 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |