C21H19NO3S — CID 98310934
(1R,2S,3R,4R)-3-[(2-phenylsulfanylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98310934) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[(2-phenylsulfanylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[(2-phenylsulfanylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98310934 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (1R,2S,3R,4R)-3-[(2-phenylsulfanylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H](C(=O)Nc2ccccc2Sc2ccccc2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C21H19NO3S/c23-20(18-13-10-11-14(12-13)19(18)21(24)25)22-16-8-4-5-9-17(16)26-15-6-2-1-3-7-15/h1-11,13-14,18-19H,12H2,(H,22,23)(H,24,25)/t13-,14-,18+,19-/m0/s1 |
| InChIKey | HTZDTCDRIHBIKK-QAMTZSDWSA-N |
| XLogP | 4.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|