C18H24N4O2 — CID 98311796
2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 98311796) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 98311796 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](NC(=O)Cn1nc3ccccn3c1=O)C2 |
| InChI | InChI=1S/C18H24N4O2/c1-17(2)12-7-8-18(17,3)13(10-12)19-15(23)11-22-16(24)21-9-5-4-6-14(21)20-22/h4-6,9,12-13H,7-8,10-11H2,1-3H3,(H,19,23)/t12-,13+,18-/m0/s1 |
| InChIKey | OQGPJIYIMWMTFQ-JCGVRSQUSA-N |
| XLogP | 1.83 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |