C22H23NO3 — CID 98313993
(4-methylphenyl)methyl (1R,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate (PubChem CID 98313993) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (4-methylphenyl)methyl (1R,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate.
| Compound Name | (4-methylphenyl)methyl (1R,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 98313993 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (4-methylphenyl)methyl (1R,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccc(C)cc2)[C@@H]2C[C@](C)(N1)Oc1ccccc12 |
| InChI | InChI=1S/C22H23NO3/c1-14-8-10-16(11-9-14)13-25-21(24)20-15(2)23-22(3)12-18(20)17-6-4-5-7-19(17)26-22/h4-11,18,23H,12-13H2,1-3H3/t18-,22-/m1/s1 |
| InChIKey | VCEGHRDMUJNBNH-XMSQKQJNSA-N |
| XLogP | 4.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |