C16H22N8O — CID 98318878
1-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(5R,7R)-3-(1,2,4-triazol-1-yl)-1-adamantyl]urea (PubChem CID 98318878) has the molecular formula C16H22N8O and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(5R,7R)-3-(1,2,4-triazol-1-yl)-1-adamantyl]urea.
| Compound Name | 1-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(5R,7R)-3-(1,2,4-triazol-1-yl)-1-adamantyl]urea |
|---|---|
| PubChem CID | 98318878 |
| Molecular Formula | C16H22N8O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(5R,7R)-3-(1,2,4-triazol-1-yl)-1-adamantyl]urea |
| SMILES | Cc1nc(NC(=O)NC23C[C@H]4C[C@H](C2)CC(n2cncn2)(C4)C3)n[nH]1 |
| InChI | InChI=1S/C16H22N8O/c1-10-19-13(23-22-10)20-14(25)21-15-3-11-2-12(4-15)6-16(5-11,7-15)24-9-17-8-18-24/h8-9,11-12H,2-7H2,1H3,(H3,19,20,21,22,23,25)/t11-,12-,15?,16?/m1/s1 |
| InChIKey | GCGAYICLBGJUCQ-CPWXYTRJSA-N |
| XLogP | 1.57 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |