C28H23FN2O3S — CID 98319039
(4E,5S)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 98319039) has the molecular formula C28H23FN2O3S and a molecular weight of 486.57 g/mol. Its IUPAC name is (4E,5S)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98319039 |
| Molecular Formula | C28H23FN2O3S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (4E,5S)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(F)cc4)[C@@H]3c3ccc(C(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C28H23FN2O3S/c1-15(2)17-5-7-18(8-6-17)24-23(25(32)19-9-11-20(29)12-10-19)26(33)27(34)31(24)28-30-21-13-4-16(3)14-22(21)35-28/h4-15,24,32H,1-3H3/b25-23+/t24-/m0/s1 |
| InChIKey | LREIKPQMWGBXQI-NXLSWJSLSA-N |
| XLogP | 6.49 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|