C14H14N4O2 — CID 98320083
(1R,6S,7R,11S,12S)-8-imino-12-methyl-13,14-dioxa-9-azatetracyclo[8.3.1.01,6.07,11]tetradec-9-ene-7,11-dicarbonitrile (PubChem CID 98320083) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is (1R,6S,7R,11S,12S)-8-imino-12-methyl-13,14-dioxa-9-azatetracyclo[8.3.1.01,6.07,11]tetradec-9-ene-7,11-dicarbonitrile.
| Compound Name | (1R,6S,7R,11S,12S)-8-imino-12-methyl-13,14-dioxa-9-azatetracyclo[8.3.1.01,6.07,11]tetradec-9-ene-7,11-dicarbonitrile |
|---|---|
| PubChem CID | 98320083 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1R,6S,7R,11S,12S)-8-imino-12-methyl-13,14-dioxa-9-azatetracyclo[8.3.1.01,6.07,11]tetradec-9-ene-7,11-dicarbonitrile |
| SMILES | [H]/N=C1\N=C2O[C@]34CCCC[C@H]3[C@]1(C#N)[C@]2(C#N)[C@H](C)O4 |
| InChI | InChI=1S/C14H14N4O2/c1-8-12(6-15)11-18-10(17)13(12,7-16)9-4-2-3-5-14(9,19-8)20-11/h8-9,17H,2-5H2,1H3/b17-10-/t8-,9-,12+,13-,14+/m0/s1 |
| InChIKey | VBDWMGGEXKKEPA-GYTHNEOESA-N |
| XLogP | 1.73 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|