C32H36N2O6 — CID 98321895
(4E,5S)-1-[3-(dimethylamino)propyl]-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 98321895) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is (4E,5S)-1-[3-(dimethylamino)propyl]-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-[3-(dimethylamino)propyl]-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98321895 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | (4E,5S)-1-[3-(dimethylamino)propyl]-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@H]2/C(=C(\O)c3ccc(OCc4ccccc4)cc3C)C(=O)C(=O)N2CCCN(C)C)ccc1O |
| InChI | InChI=1S/C32H36N2O6/c1-5-39-27-19-23(12-15-26(27)35)29-28(31(37)32(38)34(29)17-9-16-33(3)4)30(36)25-14-13-24(18-21(25)2)40-20-22-10-7-6-8-11-22/h6-8,10-15,18-19,29,35-36H,5,9,16-17,20H2,1-4H3/b30-28+/t29-/m0/s1 |
| InChIKey | WVFCFHYPMBELKA-MIOXIQPJSA-N |
| XLogP | 5.05 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|