C17H29N5O2 — CID 98322024
(2S)-2-amino-2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[(1S,5S)-9-hydroxy-1,5,7-trimethyl-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethanone (PubChem CID 98322024) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (2S)-2-amino-2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[(1S,5S)-9-hydroxy-1,5,7-trimethyl-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethanone.
| Compound Name | (2S)-2-amino-2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[(1S,5S)-9-hydroxy-1,5,7-trimethyl-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethanone |
|---|---|
| PubChem CID | 98322024 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (2S)-2-amino-2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[(1S,5S)-9-hydroxy-1,5,7-trimethyl-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethanone |
| SMILES | Cc1n[nH]c(C)c1[C@H](N)C(=O)N1C[C@]2(C)CN(C)C[C@@](C)(C1)C2O |
| InChI | InChI=1S/C17H29N5O2/c1-10-12(11(2)20-19-10)13(18)14(23)22-8-16(3)6-21(5)7-17(4,9-22)15(16)24/h13,15,24H,6-9,18H2,1-5H3,(H,19,20)/t13-,16-,17-/m0/s1 |
| InChIKey | DGGZISIEXLYEML-JQFCIGGWSA-N |
| XLogP | 0.19 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |