C33H35NO6 — CID 98323476
(4E,5S)-1-benzyl-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 98323476) has the molecular formula C33H35NO6 and a molecular weight of 541.64 g/mol. Its IUPAC name is (4E,5S)-1-benzyl-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-benzyl-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98323476 |
| Molecular Formula | C33H35NO6 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | (4E,5S)-1-benzyl-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@H]2/C(=C(\O)c3ccc4c(c3)C[C@@H](C)O4)C(=O)C(=O)N2Cc2ccccc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C33H35NO6/c1-20(2)14-15-39-27-13-10-23(18-28(27)38-4)30-29(31(35)24-11-12-26-25(17-24)16-21(3)40-26)32(36)33(37)34(30)19-22-8-6-5-7-9-22/h5-13,17-18,20-21,30,35H,14-16,19H2,1-4H3/b31-29+/t21-,30+/m1/s1 |
| InChIKey | RUOPKXJHGLHQRE-ICQXDZJJSA-N |
| XLogP | 6.07 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|