C27H23BrN2O6 — CID 98325493
(4E,5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 98325493) has the molecular formula C27H23BrN2O6 and a molecular weight of 551.39 g/mol. Its IUPAC name is (4E,5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98325493 |
| Molecular Formula | C27H23BrN2O6 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | (4E,5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@H]2/C(=C(\O)c3ccc4c(c3)C[C@@H](C)O4)C(=O)C(=O)N2Cc2cccnc2)cc(Br)c1O |
| InChI | InChI=1S/C27H23BrN2O6/c1-14-8-17-9-16(5-6-20(17)36-14)24(31)22-23(18-10-19(28)25(32)21(11-18)35-2)30(27(34)26(22)33)13-15-4-3-7-29-12-15/h3-7,9-12,14,23,31-32H,8,13H2,1-2H3/b24-22+/t14-,23+/m1/s1 |
| InChIKey | RHQIXUSJAMVBKZ-HPASZNQBSA-N |
| XLogP | 4.50 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|