C22H24N2O — CID 98327894
(3'R,5S,10bR)-3'-methyl-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,1'-cyclohexane] (PubChem CID 98327894) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (3'R,5S,10bR)-3'-methyl-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,1'-cyclohexane].
| Compound Name | (3'R,5S,10bR)-3'-methyl-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,1'-cyclohexane] |
|---|---|
| PubChem CID | 98327894 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (3'R,5S,10bR)-3'-methyl-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,1'-cyclohexane] |
| SMILES | C[C@@H]1CCC[C@@]2(C1)Oc1ccccc1[C@H]1CC(c3ccccc3)=NN12 |
| InChI | InChI=1S/C22H24N2O/c1-16-8-7-13-22(15-16)24-20(18-11-5-6-12-21(18)25-22)14-19(23-24)17-9-3-2-4-10-17/h2-6,9-12,16,20H,7-8,13-15H2,1H3/t16-,20-,22+/m1/s1 |
| InChIKey | NTDBRNJTVVMTAD-CNDZOEFASA-N |
| XLogP | 5.14 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |