C16H14N4O4 — CID 98328992
1-[2-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 98328992) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1-[2-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 98328992 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-[2-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@@H]1C(=O)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C16H14N4O4/c1-10-14(12(21)9-19-8-7-13(22)17-16(19)24)15(23)20(18-10)11-5-3-2-4-6-11/h2-8,14H,9H2,1H3,(H,17,22,24)/t14-/m0/s1 |
| InChIKey | PKNLHUHHRSQCKS-AWEZNQCLSA-N |
| XLogP | 0.14 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|