C18H27N3O — CID 98329428
(5S,7S)-3-[(1S)-1-[(4,6-dimethylpyrimidin-2-yl)amino]ethyl]adamantan-1-ol (PubChem CID 98329428) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (5S,7S)-3-[(1S)-1-[(4,6-dimethylpyrimidin-2-yl)amino]ethyl]adamantan-1-ol.
| Compound Name | (5S,7S)-3-[(1S)-1-[(4,6-dimethylpyrimidin-2-yl)amino]ethyl]adamantan-1-ol |
|---|---|
| PubChem CID | 98329428 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (5S,7S)-3-[(1S)-1-[(4,6-dimethylpyrimidin-2-yl)amino]ethyl]adamantan-1-ol |
| SMILES | Cc1cc(C)nc(N[C@@H](C)C23C[C@@H]4C[C@H](CC(O)(C4)C2)C3)n1 |
| InChI | InChI=1S/C18H27N3O/c1-11-4-12(2)20-16(19-11)21-13(3)17-6-14-5-15(7-17)9-18(22,8-14)10-17/h4,13-15,22H,5-10H2,1-3H3,(H,19,20,21)/t13-,14-,15-,17?,18?/m0/s1 |
| InChIKey | FMCJEZBUNQADHX-COTXFKEESA-N |
| XLogP | 3.23 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |