C26H19F3N2O7 — CID 98329719
(4E,5S)-5-(2,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 98329719) has the molecular formula C26H19F3N2O7 and a molecular weight of 528.44 g/mol. Its IUPAC name is (4E,5S)-5-(2,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(2,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98329719 |
| Molecular Formula | C26H19F3N2O7 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (4E,5S)-5-(2,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc([C@H]2/C(=C(\O)c3ccc([N+](=O)[O-])cc3)C(=O)C(=O)N2c2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C26H19F3N2O7/c1-37-18-10-11-19(20(13-18)38-2)22-21(23(32)14-6-8-16(9-7-14)31(35)36)24(33)25(34)30(22)17-5-3-4-15(12-17)26(27,28)29/h3-13,22,32H,1-2H3/b23-21+/t22-/m0/s1 |
| InChIKey | RZMFZJNXDCJEBC-MOBKVPTQSA-N |
| XLogP | 5.26 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|