C23H24N4O7 — CID 98330995
(4E,5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 98330995) has the molecular formula C23H24N4O7 and a molecular weight of 468.47 g/mol. Its IUPAC name is (4E,5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98330995 |
| Molecular Formula | C23H24N4O7 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (4E,5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)/C(=C(/O)c2ccc([N+](=O)[O-])cc2)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H24N4O7/c1-3-24(4-2)12-13-25-20(16-6-5-7-18(14-16)27(33)34)19(22(29)23(25)30)21(28)15-8-10-17(11-9-15)26(31)32/h5-11,14,20,28H,3-4,12-13H2,1-2H3/b21-19+/t20-/m0/s1 |
| InChIKey | WWCKRNXZCKFJOO-NHFXJNLRSA-N |
| XLogP | 3.27 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|