C33H31N3O6S2 — CID 98331733
(4E,5S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98331733) has the molecular formula C33H31N3O6S2 and a molecular weight of 629.76 g/mol. Its IUPAC name is (4E,5S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98331733 |
| Molecular Formula | C33H31N3O6S2 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | (4E,5S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1cccc([C@H]2/C(=C(\O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nnc(SCc3ccccc3)s2)c1 |
| InChI | InChI=1S/C33H31N3O6S2/c1-2-3-7-15-40-24-12-8-11-22(18-24)28-27(29(37)23-13-14-25-26(19-23)42-17-16-41-25)30(38)31(39)36(28)32-34-35-33(44-32)43-20-21-9-5-4-6-10-21/h4-6,8-14,18-19,28,37H,2-3,7,15-17,20H2,1H3/b29-27+/t28-/m0/s1 |
| InChIKey | TYYVOUWXXDTTBI-TXTDGAROSA-N |
| XLogP | 6.80 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|