C24H31NO2 — CID 98331807
3-[4-[(5R,7R)-3-hydroxy-1-adamantyl]anilino]-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 98331807) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 3-[4-[(5R,7R)-3-hydroxy-1-adamantyl]anilino]-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 3-[4-[(5R,7R)-3-hydroxy-1-adamantyl]anilino]-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 98331807 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 3-[4-[(5R,7R)-3-hydroxy-1-adamantyl]anilino]-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C=C(Nc2ccc(C34C[C@H]5C[C@@H](CC(O)(C5)C3)C4)cc2)C1 |
| InChI | InChI=1S/C24H31NO2/c1-22(2)13-20(8-21(26)14-22)25-19-5-3-18(4-6-19)23-9-16-7-17(10-23)12-24(27,11-16)15-23/h3-6,8,16-17,25,27H,7,9-15H2,1-2H3/t16-,17-,23?,24?/m1/s1 |
| InChIKey | RXVHZEQPUATCGF-WADIDORASA-N |
| XLogP | 4.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |