C30H32N6O5 — CID 98333571
7-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methylpurine-2,6-dione (PubChem CID 98333571) has the molecular formula C30H32N6O5 and a molecular weight of 556.62 g/mol. Its IUPAC name is 7-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methylpurine-2,6-dione.
| Compound Name | 7-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 98333571 |
| Molecular Formula | C30H32N6O5 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 7-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methylpurine-2,6-dione |
| SMILES | COc1ccc(N2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3C[C@@H](O)COc3ccc4ccccc4c3)CC2)cc1 |
| InChI | InChI=1S/C30H32N6O5/c1-33-27-26(28(38)32-30(33)39)36(18-23(37)19-41-25-10-7-20-5-3-4-6-21(20)17-25)29(31-27)35-15-13-34(14-16-35)22-8-11-24(40-2)12-9-22/h3-12,17,23,37H,13-16,18-19H2,1-2H3,(H,32,38,39)/t23-/m1/s1 |
| InChIKey | LYTCAESNJVSIBQ-HSZRJFAPSA-N |
| XLogP | 2.35 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|